C18H25FN2O2 — CID 95325298
1-[(2S)-2-[(2S)-1-[2-(3-fluorophenoxy)ethyl]pyrrolidin-2-yl]pyrrolidin-1-yl]ethanone (PubChem CID 95325298) has the molecular formula C18H25FN2O2 and a molecular weight of 320.41 g/mol. Its IUPAC name is 1-[(2S)-2-[(2S)-1-[2-(3-fluorophenoxy)ethyl]pyrrolidin-2-yl]pyrrolidin-1-yl]ethanone.
| Compound Name | 1-[(2S)-2-[(2S)-1-[2-(3-fluorophenoxy)ethyl]pyrrolidin-2-yl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 95325298 |
| Molecular Formula | C18H25FN2O2 |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 1-[(2S)-2-[(2S)-1-[2-(3-fluorophenoxy)ethyl]pyrrolidin-2-yl]pyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC[C@H]1[C@@H]1CCCN1CCOc1cccc(F)c1 |
| InChI | InChI=1S/C18H25FN2O2/c1-14(22)21-10-4-8-18(21)17-7-3-9-20(17)11-12-23-16-6-2-5-15(19)13-16/h2,5-6,13,17-18H,3-4,7-12H2,1H3/t17-,18-/m0/s1 |
| InChIKey | LUAYGKYAXRMGCM-ROUUACIJSA-N |
| XLogP | 2.68 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |