C19H27FN2O2 — CID 95346776
1-[(2R)-2-[(2R)-1-[3-(4-fluorophenoxy)propyl]pyrrolidin-2-yl]pyrrolidin-1-yl]ethanone (PubChem CID 95346776) has the molecular formula C19H27FN2O2 and a molecular weight of 334.43 g/mol. Its IUPAC name is 1-[(2R)-2-[(2R)-1-[3-(4-fluorophenoxy)propyl]pyrrolidin-2-yl]pyrrolidin-1-yl]ethanone.
| Compound Name | 1-[(2R)-2-[(2R)-1-[3-(4-fluorophenoxy)propyl]pyrrolidin-2-yl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 95346776 |
| Molecular Formula | C19H27FN2O2 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 1-[(2R)-2-[(2R)-1-[3-(4-fluorophenoxy)propyl]pyrrolidin-2-yl]pyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC[C@@H]1[C@H]1CCCN1CCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C19H27FN2O2/c1-15(23)22-13-3-6-19(22)18-5-2-11-21(18)12-4-14-24-17-9-7-16(20)8-10-17/h7-10,18-19H,2-6,11-14H2,1H3/t18-,19-/m1/s1 |
| InChIKey | UZRMGAURNJRCPJ-RTBURBONSA-N |
| XLogP | 3.07 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|