C15H25BN2O3 — CID 114087203
[3-[2-(2,4-dimethyl-1,4-diazepan-1-yl)ethoxy]phenyl]boronic acid (PubChem CID 114087203) has the molecular formula C15H25BN2O3 and a molecular weight of 292.19 g/mol. Its IUPAC name is [3-[2-(2,4-dimethyl-1,4-diazepan-1-yl)ethoxy]phenyl]boronic acid.
| Compound Name | [3-[2-(2,4-dimethyl-1,4-diazepan-1-yl)ethoxy]phenyl]boronic acid |
|---|---|
| PubChem CID | 114087203 |
| Molecular Formula | C15H25BN2O3 |
| Molecular Weight | 292.19 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | [3-[2-(2,4-dimethyl-1,4-diazepan-1-yl)ethoxy]phenyl]boronic acid |
| SMILES | CC1CN(C)CCCN1CCOc1cccc(B(O)O)c1 |
| InChI | InChI=1S/C15H25BN2O3/c1-13-12-17(2)7-4-8-18(13)9-10-21-15-6-3-5-14(11-15)16(19)20/h3,5-6,11,13,19-20H,4,7-10,12H2,1-2H3 |
| InChIKey | MAYFUXRKLDCMQM-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.19 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|