[3-[2-(4-methyl-2-oxo-1-pyridinyl)ethoxy]phenyl]boronic acid

C14H16BNO4 — CID 62962131

IUPAC[3-[2-(4-methyl-2-oxo-1-pyridinyl)ethoxy]phenyl]boronic acid
SMILESCc1ccn(CCOc2cccc(B(O)O)c2)c(=O)c1
InChIInChI=1S/C14H16BNO4/c1-11-5-6-16(14(17)9-11)7-8-20-13-4-2-3-12(10-13)15(18)19/h2-6,9-10,18-19H,7-8H2,1H3
InChIKeyOSZPXWIMPYCJMY-UHFFFAOYSA-N
MW273.10 g/mol
LogP-0.08
Rot. Bonds5

About [3-[2-(4-methyl-2-oxo-1-pyridinyl)ethoxy]phenyl]boronic acid

[3-[2-(4-methyl-2-oxo-1-pyridinyl)ethoxy]phenyl]boronic acid (PubChem CID 62962131) has the molecular formula C14H16BNO4 and a molecular weight of 273.10 g/mol. Its IUPAC name is [3-[2-(4-methyl-2-oxo-1-pyridinyl)ethoxy]phenyl]boronic acid.

Molecular Properties

Compound Name[3-[2-(4-methyl-2-oxo-1-pyridinyl)ethoxy]phenyl]boronic acid
PubChem CID62962131
Molecular FormulaC14H16BNO4
Molecular Weight273.10 g/mol
Exact Mass273.12
IUPAC Name[3-[2-(4-methyl-2-oxo-1-pyridinyl)ethoxy]phenyl]boronic acid
SMILESCc1ccn(CCOc2cccc(B(O)O)c2)c(=O)c1
InChIInChI=1S/C14H16BNO4/c1-11-5-6-16(14(17)9-11)7-8-20-13-4-2-3-12(10-13)15(18)19/h2-6,9-10,18-19H,7-8H2,1H3
InChIKeyOSZPXWIMPYCJMY-UHFFFAOYSA-N
XLogP-0.08
TPSA71.69 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.10
LogP ≤ 5-0.08
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [3-[2-(4-methyl-2-oxo-1-pyridinyl)ethoxy]phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [3-[2-(4-methyl-2-oxo-1-pyridinyl)ethoxy]phenyl]boronic acid?
The IUPAC name of [3-[2-(4-methyl-2-oxo-1-pyridinyl)ethoxy]phenyl]boronic acid (CID 62962131) is [3-[2-(4-methyl-2-oxo-1-pyridinyl)ethoxy]phenyl]boronic acid.
What is the SMILES notation for [3-[2-(4-methyl-2-oxo-1-pyridinyl)ethoxy]phenyl]boronic acid?
The canonical SMILES for [3-[2-(4-methyl-2-oxo-1-pyridinyl)ethoxy]phenyl]boronic acid is Cc1ccn(CCOc2cccc(B(O)O)c2)c(=O)c1.
What is the InChIKey of [3-[2-(4-methyl-2-oxo-1-pyridinyl)ethoxy]phenyl]boronic acid?
The InChIKey is OSZPXWIMPYCJMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16BNO4/c1-11-5-6-16(14(17)9-11)7-8-20-13-4-2-3-12(10-13)15(18)19/h2-6,9-10,18-19H,7-8H2,1H3.
What are the key properties of [3-[2-(4-methyl-2-oxo-1-pyridinyl)ethoxy]phenyl]boronic acid?
[3-[2-(4-methyl-2-oxo-1-pyridinyl)ethoxy]phenyl]boronic acid has a molecular weight of 273.10 g/mol, XLogP of -0.08, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2-(4-methyl-2-oxo-1-pyridinyl)ethoxy]phenyl]boronic acid is sourced from PubChem (CID 62962131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).