C14H19BN2O3S — CID 63838814
[3-[2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]ethoxy]phenyl]boronic acid (PubChem CID 63838814) has the molecular formula C14H19BN2O3S and a molecular weight of 306.20 g/mol. Its IUPAC name is [3-[2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]ethoxy]phenyl]boronic acid.
| Compound Name | [3-[2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]ethoxy]phenyl]boronic acid |
|---|---|
| PubChem CID | 63838814 |
| Molecular Formula | C14H19BN2O3S |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | [3-[2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]ethoxy]phenyl]boronic acid |
| SMILES | Cc1ncsc1CN(C)CCOc1cccc(B(O)O)c1 |
| InChI | InChI=1S/C14H19BN2O3S/c1-11-14(21-10-16-11)9-17(2)6-7-20-13-5-3-4-12(8-13)15(18)19/h3-5,8,10,18-19H,6-7,9H2,1-2H3 |
| InChIKey | SGMUHZHNPQGKIV-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|