C13H22BNO3S — CID 112663866
[3-[2-[methyl(1-methylsulfanylpropan-2-yl)amino]ethoxy]phenyl]boronic acid (PubChem CID 112663866) has the molecular formula C13H22BNO3S and a molecular weight of 283.20 g/mol. Its IUPAC name is [3-[2-[methyl(1-methylsulfanylpropan-2-yl)amino]ethoxy]phenyl]boronic acid.
| Compound Name | [3-[2-[methyl(1-methylsulfanylpropan-2-yl)amino]ethoxy]phenyl]boronic acid |
|---|---|
| PubChem CID | 112663866 |
| Molecular Formula | C13H22BNO3S |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | [3-[2-[methyl(1-methylsulfanylpropan-2-yl)amino]ethoxy]phenyl]boronic acid |
| SMILES | CSCC(C)N(C)CCOc1cccc(B(O)O)c1 |
| InChI | InChI=1S/C13H22BNO3S/c1-11(10-19-3)15(2)7-8-18-13-6-4-5-12(9-13)14(16)17/h4-6,9,11,16-17H,7-8,10H2,1-3H3 |
| InChIKey | CSLNPHIBIIXDPM-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|