C10H18N2O2S — CID 63837503
2-[2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]ethoxy]ethanol (PubChem CID 63837503) has the molecular formula C10H18N2O2S and a molecular weight of 230.33 g/mol. Its IUPAC name is 2-[2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]ethoxy]ethanol.
| Compound Name | 2-[2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 63837503 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2-[2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]ethoxy]ethanol |
| SMILES | Cc1ncsc1CN(C)CCOCCO |
| InChI | InChI=1S/C10H18N2O2S/c1-9-10(15-8-11-9)7-12(2)3-5-14-6-4-13/h8,13H,3-7H2,1-2H3 |
| InChIKey | MDVJRHDEDCIXEY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|