C11H17N3S — CID 55259281
5-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]pentanenitrile (PubChem CID 55259281) has the molecular formula C11H17N3S and a molecular weight of 223.34 g/mol. Its IUPAC name is 5-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]pentanenitrile.
| Compound Name | 5-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]pentanenitrile |
|---|---|
| PubChem CID | 55259281 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 5-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]pentanenitrile |
| SMILES | Cc1ncsc1CN(C)CCCCC#N |
| InChI | InChI=1S/C11H17N3S/c1-10-11(15-9-13-10)8-14(2)7-5-3-4-6-12/h9H,3-5,7-8H2,1-2H3 |
| InChIKey | FMLCRSFOWILQIO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|