C13H22BNO3 — CID 81061421
[3-[[methyl(2-propan-2-yloxyethyl)amino]methyl]phenyl]boronic acid (PubChem CID 81061421) has the molecular formula C13H22BNO3 and a molecular weight of 251.14 g/mol. Its IUPAC name is [3-[[methyl(2-propan-2-yloxyethyl)amino]methyl]phenyl]boronic acid.
| Compound Name | [3-[[methyl(2-propan-2-yloxyethyl)amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 81061421 |
| Molecular Formula | C13H22BNO3 |
| Molecular Weight | 251.14 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | [3-[[methyl(2-propan-2-yloxyethyl)amino]methyl]phenyl]boronic acid |
| SMILES | CC(C)OCCN(C)Cc1cccc(B(O)O)c1 |
| InChI | InChI=1S/C13H22BNO3/c1-11(2)18-8-7-15(3)10-12-5-4-6-13(9-12)14(16)17/h4-6,9,11,16-17H,7-8,10H2,1-3H3 |
| InChIKey | ZYYJINWHJRXUDX-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.14 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|