C17H26O3 — CID 103159069
1-cyclopentyl-3-[4-[(1R)-1-hydroxyethyl]-2-methylphenoxy]propan-2-ol (PubChem CID 103159069) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 1-cyclopentyl-3-[4-[(1R)-1-hydroxyethyl]-2-methylphenoxy]propan-2-ol.
| Compound Name | 1-cyclopentyl-3-[4-[(1R)-1-hydroxyethyl]-2-methylphenoxy]propan-2-ol |
|---|---|
| PubChem CID | 103159069 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 1-cyclopentyl-3-[4-[(1R)-1-hydroxyethyl]-2-methylphenoxy]propan-2-ol |
| SMILES | Cc1cc([C@@H](C)O)ccc1OCC(O)CC1CCCC1 |
| InChI | InChI=1S/C17H26O3/c1-12-9-15(13(2)18)7-8-17(12)20-11-16(19)10-14-5-3-4-6-14/h7-9,13-14,16,18-19H,3-6,10-11H2,1-2H3/t13-,16?/m1/s1 |
| InChIKey | UMRGGLUOXLFWSH-JBZHPUCOSA-N |
| XLogP | 3.37 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |