C17H26O3 — CID 103260703
1-cyclopentyl-3-(4-ethyl-2-methoxyphenoxy)propan-2-ol (PubChem CID 103260703) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 1-cyclopentyl-3-(4-ethyl-2-methoxyphenoxy)propan-2-ol.
| Compound Name | 1-cyclopentyl-3-(4-ethyl-2-methoxyphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 103260703 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 1-cyclopentyl-3-(4-ethyl-2-methoxyphenoxy)propan-2-ol |
| SMILES | CCc1ccc(OCC(O)CC2CCCC2)c(OC)c1 |
| InChI | InChI=1S/C17H26O3/c1-3-13-8-9-16(17(11-13)19-2)20-12-15(18)10-14-6-4-5-7-14/h8-9,11,14-15,18H,3-7,10,12H2,1-2H3 |
| InChIKey | GVWWQFWVKWZBJG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |