C18H26O5 — CID 167777930
methyl 2-[4-(2-cyclopentyl-2-methoxyethoxy)-3-methoxyphenyl]acetate (PubChem CID 167777930) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is methyl 2-[4-(2-cyclopentyl-2-methoxyethoxy)-3-methoxyphenyl]acetate.
| Compound Name | methyl 2-[4-(2-cyclopentyl-2-methoxyethoxy)-3-methoxyphenyl]acetate |
|---|---|
| PubChem CID | 167777930 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | methyl 2-[4-(2-cyclopentyl-2-methoxyethoxy)-3-methoxyphenyl]acetate |
| SMILES | COC(=O)Cc1ccc(OCC(OC)C2CCCC2)c(OC)c1 |
| InChI | InChI=1S/C18H26O5/c1-20-16-10-13(11-18(19)22-3)8-9-15(16)23-12-17(21-2)14-6-4-5-7-14/h8-10,14,17H,4-7,11-12H2,1-3H3 |
| InChIKey | VPZIQEHOYJBTBR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |