C16H22O5 — CID 96523533
[(1R,2R)-2-methoxycyclopentyl] 2-(3,4-dimethoxyphenyl)acetate (PubChem CID 96523533) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is [(1R,2R)-2-methoxycyclopentyl] 2-(3,4-dimethoxyphenyl)acetate.
| Compound Name | [(1R,2R)-2-methoxycyclopentyl] 2-(3,4-dimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 96523533 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | [(1R,2R)-2-methoxycyclopentyl] 2-(3,4-dimethoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)O[C@@H]2CCC[C@H]2OC)cc1OC |
| InChI | InChI=1S/C16H22O5/c1-18-12-5-4-6-14(12)21-16(17)10-11-7-8-13(19-2)15(9-11)20-3/h7-9,12,14H,4-6,10H2,1-3H3/t12-,14-/m1/s1 |
| InChIKey | TYNLSWDYRICRHL-TZMCWYRMSA-N |
| XLogP | 2.36 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |