C17H28NO3+ — CID 7377931
2-(3,4-dimethoxyphenyl)ethyl-[(1R,2R)-2-methoxycyclohexyl]azanium (PubChem CID 7377931) has the molecular formula C17H28NO3+ and a molecular weight of 294.42 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)ethyl-[(1R,2R)-2-methoxycyclohexyl]azanium.
| Compound Name | 2-(3,4-dimethoxyphenyl)ethyl-[(1R,2R)-2-methoxycyclohexyl]azanium |
|---|---|
| PubChem CID | 7377931 |
| Molecular Formula | C17H28NO3+ |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)ethyl-[(1R,2R)-2-methoxycyclohexyl]azanium |
| SMILES | COc1ccc(CC[NH2+][C@@H]2CCCC[C@H]2OC)cc1OC |
| InChI | InChI=1S/C17H27NO3/c1-19-15-7-5-4-6-14(15)18-11-10-13-8-9-16(20-2)17(12-13)21-3/h8-9,12,14-15,18H,4-7,10-11H2,1-3H3/p+1/t14-,15-/m1/s1 |
| InChIKey | AGSMUKLNMPEAMR-HUUCEWRRSA-O |
| XLogP | 1.77 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |