C20H31NO3 — CID 16735227
1-[(1R,2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidine (PubChem CID 16735227) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is 1-[(1R,2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidine.
| Compound Name | 1-[(1R,2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidine |
|---|---|
| PubChem CID | 16735227 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | 1-[(1R,2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]pyrrolidine |
| SMILES | COc1ccc(CCO[C@@H]2CCCC[C@H]2N2CCCC2)cc1OC |
| InChI | InChI=1S/C20H31NO3/c1-22-19-10-9-16(15-20(19)23-2)11-14-24-18-8-4-3-7-17(18)21-12-5-6-13-21/h9-10,15,17-18H,3-8,11-14H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | GFEAFIVEZCBUNS-QZTJIDSGSA-N |
| XLogP | 3.67 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |