C21H33NO4 — CID 58648750
4-[(2S)-2-[3-(3,4-dimethoxyphenyl)propoxy]cyclohexyl]morpholine (PubChem CID 58648750) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is 4-[(2S)-2-[3-(3,4-dimethoxyphenyl)propoxy]cyclohexyl]morpholine.
| Compound Name | 4-[(2S)-2-[3-(3,4-dimethoxyphenyl)propoxy]cyclohexyl]morpholine |
|---|---|
| PubChem CID | 58648750 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 4-[(2S)-2-[3-(3,4-dimethoxyphenyl)propoxy]cyclohexyl]morpholine |
| SMILES | COc1ccc(CCCO[C@H]2CCCCC2N2CCOCC2)cc1OC |
| InChI | InChI=1S/C21H33NO4/c1-23-20-10-9-17(16-21(20)24-2)6-5-13-26-19-8-4-3-7-18(19)22-11-14-25-15-12-22/h9-10,16,18-19H,3-8,11-15H2,1-2H3/t18?,19-/m0/s1 |
| InChIKey | FNCANBLHFUSJFD-GGYWPGCISA-N |
| XLogP | 3.30 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|