C21H35ClN2O3 — CID 161264046
(1S)-N-[3-(3,4-dimethoxyphenyl)propyl]-2-morpholin-4-ylcyclohexan-1-amine;hydrochloride (PubChem CID 161264046) has the molecular formula C21H35ClN2O3 and a molecular weight of 398.98 g/mol. Its IUPAC name is (1S)-N-[3-(3,4-dimethoxyphenyl)propyl]-2-morpholin-4-ylcyclohexan-1-amine;hydrochloride.
| Compound Name | (1S)-N-[3-(3,4-dimethoxyphenyl)propyl]-2-morpholin-4-ylcyclohexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 161264046 |
| Molecular Formula | C21H35ClN2O3 |
| Molecular Weight | 398.98 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | (1S)-N-[3-(3,4-dimethoxyphenyl)propyl]-2-morpholin-4-ylcyclohexan-1-amine;hydrochloride |
| SMILES | COc1ccc(CCCN[C@H]2CCCCC2N2CCOCC2)cc1OC.Cl |
| InChI | InChI=1S/C21H34N2O3.ClH/c1-24-20-10-9-17(16-21(20)25-2)6-5-11-22-18-7-3-4-8-19(18)23-12-14-26-15-13-23;/h9-10,16,18-19,22H,3-8,11-15H2,1-2H3;1H/t18-,19?;/m0./s1 |
| InChIKey | IWNZRSRZIFRVOU-HMEPSURWSA-N |
| XLogP | 3.29 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.98 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|