C19H29NO6 — CID 171324459
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylcyclohexan-1-amine;oxalic acid (PubChem CID 171324459) has the molecular formula C19H29NO6 and a molecular weight of 367.44 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylcyclohexan-1-amine;oxalic acid.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylcyclohexan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 171324459 |
| Molecular Formula | C19H29NO6 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylcyclohexan-1-amine;oxalic acid |
| SMILES | COc1ccc(CCNC2CCCCC2C)cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H27NO2.C2H2O4/c1-13-6-4-5-7-15(13)18-11-10-14-8-9-16(19-2)17(12-14)20-3;3-1(4)2(5)6/h8-9,12-13,15,18H,4-7,10-11H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | UFXMUNYIKDRXPC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|