C20H31NO4 — CID 67478147
4-[[(1R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]amino]butan-2-one (PubChem CID 67478147) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is 4-[[(1R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]amino]butan-2-one.
| Compound Name | 4-[[(1R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]amino]butan-2-one |
|---|---|
| PubChem CID | 67478147 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | 4-[[(1R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]amino]butan-2-one |
| SMILES | COc1ccc(CCOC2CCCC[C@H]2NCCC(C)=O)cc1OC |
| InChI | InChI=1S/C20H31NO4/c1-15(22)10-12-21-17-6-4-5-7-18(17)25-13-11-16-8-9-19(23-2)20(14-16)24-3/h8-9,14,17-18,21H,4-7,10-13H2,1-3H3/t17-,18?/m1/s1 |
| InChIKey | ZQLZPISETUWDFC-QNSVNVJESA-N |
| XLogP | 3.14 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |