C17H25NO4 — CID 126658675
(1R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexane-1-carboxamide (PubChem CID 126658675) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is (1R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexane-1-carboxamide.
| Compound Name | (1R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 126658675 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | (1R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexane-1-carboxamide |
| SMILES | COc1ccc(CCOC2CCCC[C@H]2C(N)=O)cc1OC |
| InChI | InChI=1S/C17H25NO4/c1-20-15-8-7-12(11-16(15)21-2)9-10-22-14-6-4-3-5-13(14)17(18)19/h7-8,11,13-14H,3-6,9-10H2,1-2H3,(H2,18,19)/t13-,14?/m1/s1 |
| InChIKey | QKBHUYGBZSVYQL-KWCCSABGSA-N |
| XLogP | 2.31 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |