C24H30O5 — CID 126658684
benzyl (2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexane-1-carboxylate (PubChem CID 126658684) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is benzyl (2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexane-1-carboxylate.
| Compound Name | benzyl (2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 126658684 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | benzyl (2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexane-1-carboxylate |
| SMILES | COc1ccc(CCO[C@@H]2CCCCC2C(=O)OCc2ccccc2)cc1OC |
| InChI | InChI=1S/C24H30O5/c1-26-22-13-12-18(16-23(22)27-2)14-15-28-21-11-7-6-10-20(21)24(25)29-17-19-8-4-3-5-9-19/h3-5,8-9,12-13,16,20-21H,6-7,10-11,14-15,17H2,1-2H3/t20?,21-/m1/s1 |
| InChIKey | NTASHYISWSGBDI-BPGUCPLFSA-N |
| XLogP | 4.57 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |