C20H32N2O3 — CID 16737718
1-[(1R,2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]piperazine (PubChem CID 16737718) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is 1-[(1R,2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]piperazine.
| Compound Name | 1-[(1R,2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]piperazine |
|---|---|
| PubChem CID | 16737718 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | 1-[(1R,2R)-2-[2-(3,4-dimethoxyphenyl)ethoxy]cyclohexyl]piperazine |
| SMILES | COc1ccc(CCO[C@@H]2CCCC[C@H]2N2CCNCC2)cc1OC |
| InChI | InChI=1S/C20H32N2O3/c1-23-19-8-7-16(15-20(19)24-2)9-14-25-18-6-4-3-5-17(18)22-12-10-21-11-13-22/h7-8,15,17-18,21H,3-6,9-14H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | HNDXSQDAAHOVRN-QZTJIDSGSA-N |
| XLogP | 2.48 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |