C23H39NO4 — CID 71132254
4-[2-[(2R)-2-[[(3S)-3-butoxybutyl]amino]cyclohexyl]oxyethyl]-2-methoxyphenol (PubChem CID 71132254) has the molecular formula C23H39NO4 and a molecular weight of 393.57 g/mol. Its IUPAC name is 4-[2-[(2R)-2-[[(3S)-3-butoxybutyl]amino]cyclohexyl]oxyethyl]-2-methoxyphenol.
| Compound Name | 4-[2-[(2R)-2-[[(3S)-3-butoxybutyl]amino]cyclohexyl]oxyethyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 71132254 |
| Molecular Formula | C23H39NO4 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.29 |
| IUPAC Name | 4-[2-[(2R)-2-[[(3S)-3-butoxybutyl]amino]cyclohexyl]oxyethyl]-2-methoxyphenol |
| SMILES | CCCCO[C@@H](C)CCN[C@@H]1CCCCC1OCCc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C23H39NO4/c1-4-5-15-27-18(2)12-14-24-20-8-6-7-9-22(20)28-16-13-19-10-11-21(25)23(17-19)26-3/h10-11,17-18,20,22,24-25H,4-9,12-16H2,1-3H3/t18-,20+,22?/m0/s1 |
| InChIKey | JLYHBPFUTKYBKG-RUYIAYPLSA-N |
| XLogP | 4.46 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|