C14H24O4 — CID 66730782
4-(butoxymethyl)-2-methoxyphenol;ethanol (PubChem CID 66730782) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is 4-(butoxymethyl)-2-methoxyphenol;ethanol.
| Compound Name | 4-(butoxymethyl)-2-methoxyphenol;ethanol |
|---|---|
| PubChem CID | 66730782 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 4-(butoxymethyl)-2-methoxyphenol;ethanol |
| SMILES | CCCCOCc1ccc(O)c(OC)c1.CCO |
| InChI | InChI=1S/C12H18O3.C2H6O/c1-3-4-7-15-9-10-5-6-11(13)12(8-10)14-2;1-2-3/h5-6,8,13H,3-4,7,9H2,1-2H3;3H,2H2,1H3 |
| InChIKey | YPZUCAZLJTXGEE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|