About 4-(hydroxymethyl)-2-methoxyphenol;1-pentoxypentane
4-(hydroxymethyl)-2-methoxyphenol;1-pentoxypentane (PubChem CID 71151145) has the molecular formula C18H32O4
and a molecular weight of 312.45 g/mol. Its IUPAC name is 4-(hydroxymethyl)-2-methoxyphenol;1-pentoxypentane.
Molecular Properties
| Compound Name | 4-(hydroxymethyl)-2-methoxyphenol;1-pentoxypentane |
| PubChem CID | 71151145 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 4-(hydroxymethyl)-2-methoxyphenol;1-pentoxypentane |
| SMILES | CCCCCOCCCCC.COc1cc(CO)ccc1O |
| InChI | InChI=1S/C10H22O.C8H10O3/c1-3-5-7-9-11-10-8-6-4-2;1-11-8-4-6(5-9)2-3-7(8)10/h3-10H2,1-2H3;2-4,9-10H,5H2,1H3 |
| InChIKey | RPHONJNCVWDZBE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(hydroxymethyl)-2-methoxyphenol;1-pentoxypentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)-2-methoxyphenol;1-pentoxypentane?
The IUPAC name of 4-(hydroxymethyl)-2-methoxyphenol;1-pentoxypentane (CID 71151145) is 4-(hydroxymethyl)-2-methoxyphenol;1-pentoxypentane.
What is the SMILES notation for 4-(hydroxymethyl)-2-methoxyphenol;1-pentoxypentane?
The canonical SMILES for 4-(hydroxymethyl)-2-methoxyphenol;1-pentoxypentane is CCCCCOCCCCC.COc1cc(CO)ccc1O.
What is the InChIKey of 4-(hydroxymethyl)-2-methoxyphenol;1-pentoxypentane?
The InChIKey is RPHONJNCVWDZBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O.C8H10O3/c1-3-5-7-9-11-10-8-6-4-2;1-11-8-4-6(5-9)2-3-7(8)10/h3-10H2,1-2H3;2-4,9-10H,5H2,1H3.
What are the key properties of 4-(hydroxymethyl)-2-methoxyphenol;1-pentoxypentane?
4-(hydroxymethyl)-2-methoxyphenol;1-pentoxypentane has a molecular weight of 312.45 g/mol, XLogP of 4.28, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)-2-methoxyphenol;1-pentoxypentane is sourced from PubChem (CID 71151145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).