About 4-(hydroxymethyl)-2-methoxyphenol;1-propoxypropane
4-(hydroxymethyl)-2-methoxyphenol;1-propoxypropane (PubChem CID 66600810) has the molecular formula C14H24O4
and a molecular weight of 256.34 g/mol. Its IUPAC name is 4-(hydroxymethyl)-2-methoxyphenol;1-propoxypropane.
Molecular Properties
| Compound Name | 4-(hydroxymethyl)-2-methoxyphenol;1-propoxypropane |
| PubChem CID | 66600810 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 4-(hydroxymethyl)-2-methoxyphenol;1-propoxypropane |
| SMILES | CCCOCCC.COc1cc(CO)ccc1O |
| InChI | InChI=1S/C8H10O3.C6H14O/c1-11-8-4-6(5-9)2-3-7(8)10;1-3-5-7-6-4-2/h2-4,9-10H,5H2,1H3;3-6H2,1-2H3 |
| InChIKey | AQOQECKDVUZJBG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(hydroxymethyl)-2-methoxyphenol;1-propoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)-2-methoxyphenol;1-propoxypropane?
The IUPAC name of 4-(hydroxymethyl)-2-methoxyphenol;1-propoxypropane (CID 66600810) is 4-(hydroxymethyl)-2-methoxyphenol;1-propoxypropane.
What is the SMILES notation for 4-(hydroxymethyl)-2-methoxyphenol;1-propoxypropane?
The canonical SMILES for 4-(hydroxymethyl)-2-methoxyphenol;1-propoxypropane is CCCOCCC.COc1cc(CO)ccc1O.
What is the InChIKey of 4-(hydroxymethyl)-2-methoxyphenol;1-propoxypropane?
The InChIKey is AQOQECKDVUZJBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3.C6H14O/c1-11-8-4-6(5-9)2-3-7(8)10;1-3-5-7-6-4-2/h2-4,9-10H,5H2,1H3;3-6H2,1-2H3.
What are the key properties of 4-(hydroxymethyl)-2-methoxyphenol;1-propoxypropane?
4-(hydroxymethyl)-2-methoxyphenol;1-propoxypropane has a molecular weight of 256.34 g/mol, XLogP of 2.72, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)-2-methoxyphenol;1-propoxypropane is sourced from PubChem (CID 66600810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).