C14H20O7 — CID 175343442
acetic acid;butane-2,3-dione;4-(hydroxymethyl)-2-methoxyphenol (PubChem CID 175343442) has the molecular formula C14H20O7 and a molecular weight of 300.31 g/mol. Its IUPAC name is acetic acid;butane-2,3-dione;4-(hydroxymethyl)-2-methoxyphenol.
| Compound Name | acetic acid;butane-2,3-dione;4-(hydroxymethyl)-2-methoxyphenol |
|---|---|
| PubChem CID | 175343442 |
| Molecular Formula | C14H20O7 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | acetic acid;butane-2,3-dione;4-(hydroxymethyl)-2-methoxyphenol |
| SMILES | CC(=O)C(C)=O.CC(=O)O.COc1cc(CO)ccc1O |
| InChI | InChI=1S/C8H10O3.C4H6O2.C2H4O2/c1-11-8-4-6(5-9)2-3-7(8)10;1-3(5)4(2)6;1-2(3)4/h2-4,9-10H,5H2,1H3;1-2H3;1H3,(H,3,4) |
| InChIKey | SXUDNVUAAQNMPW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|