C16H31O8P — CID 69028004
1-butoxybutane;4-(hydroxymethyl)-2-methoxyphenol;phosphoric acid (PubChem CID 69028004) has the molecular formula C16H31O8P and a molecular weight of 382.39 g/mol. Its IUPAC name is 1-butoxybutane;4-(hydroxymethyl)-2-methoxyphenol;phosphoric acid.
| Compound Name | 1-butoxybutane;4-(hydroxymethyl)-2-methoxyphenol;phosphoric acid |
|---|---|
| PubChem CID | 69028004 |
| Molecular Formula | C16H31O8P |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 1-butoxybutane;4-(hydroxymethyl)-2-methoxyphenol;phosphoric acid |
| SMILES | CCCCOCCCC.COc1cc(CO)ccc1O.O=P(O)(O)O |
| InChI | InChI=1S/C8H10O3.C8H18O.H3O4P/c1-11-8-4-6(5-9)2-3-7(8)10;1-3-5-7-9-8-6-4-2;1-5(2,3)4/h2-4,9-10H,5H2,1H3;3-8H2,1-2H3;(H3,1,2,3,4) |
| InChIKey | GKIJMHFCDRPEAJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|