About 4-[(4-hydroxy-3-methoxyphenyl)methoxymethyl]-2-methoxyphenol;nonanoic acid
4-[(4-hydroxy-3-methoxyphenyl)methoxymethyl]-2-methoxyphenol;nonanoic acid (PubChem CID 155414838) has the molecular formula C25H36O7
and a molecular weight of 448.56 g/mol. Its IUPAC name is 4-[(4-hydroxy-3-methoxyphenyl)methoxymethyl]-2-methoxyphenol;nonanoic acid.
Molecular Properties
| Compound Name | 4-[(4-hydroxy-3-methoxyphenyl)methoxymethyl]-2-methoxyphenol;nonanoic acid |
| PubChem CID | 155414838 |
| Molecular Formula | C25H36O7 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 4-[(4-hydroxy-3-methoxyphenyl)methoxymethyl]-2-methoxyphenol;nonanoic acid |
| SMILES | CCCCCCCCC(=O)O.COc1cc(COCc2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C16H18O5.C9H18O2/c1-19-15-7-11(3-5-13(15)17)9-21-10-12-4-6-14(18)16(8-12)20-2;1-2-3-4-5-6-7-8-9(10)11/h3-8,17-18H,9-10H2,1-2H3;2-8H2,1H3,(H,10,11) |
| InChIKey | OCHNDYCJABVDGT-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-hydroxy-3-methoxyphenyl)methoxymethyl]-2-methoxyphenol;nonanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-hydroxy-3-methoxyphenyl)methoxymethyl]-2-methoxyphenol;nonanoic acid?
The IUPAC name of 4-[(4-hydroxy-3-methoxyphenyl)methoxymethyl]-2-methoxyphenol;nonanoic acid (CID 155414838) is 4-[(4-hydroxy-3-methoxyphenyl)methoxymethyl]-2-methoxyphenol;nonanoic acid.
What is the SMILES notation for 4-[(4-hydroxy-3-methoxyphenyl)methoxymethyl]-2-methoxyphenol;nonanoic acid?
The canonical SMILES for 4-[(4-hydroxy-3-methoxyphenyl)methoxymethyl]-2-methoxyphenol;nonanoic acid is CCCCCCCCC(=O)O.COc1cc(COCc2ccc(O)c(OC)c2)ccc1O.
What is the InChIKey of 4-[(4-hydroxy-3-methoxyphenyl)methoxymethyl]-2-methoxyphenol;nonanoic acid?
The InChIKey is OCHNDYCJABVDGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O5.C9H18O2/c1-19-15-7-11(3-5-13(15)17)9-21-10-12-4-6-14(18)16(8-12)20-2;1-2-3-4-5-6-7-8-9(10)11/h3-8,17-18H,9-10H2,1-2H3;2-8H2,1H3,(H,10,11).
What are the key properties of 4-[(4-hydroxy-3-methoxyphenyl)methoxymethyl]-2-methoxyphenol;nonanoic acid?
4-[(4-hydroxy-3-methoxyphenyl)methoxymethyl]-2-methoxyphenol;nonanoic acid has a molecular weight of 448.56 g/mol, XLogP of 5.65, 13 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-hydroxy-3-methoxyphenyl)methoxymethyl]-2-methoxyphenol;nonanoic acid is sourced from PubChem (CID 155414838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).