About ethoxyethane;(4-hydroxy-3-methoxyphenyl)methyl nonanoate
ethoxyethane;(4-hydroxy-3-methoxyphenyl)methyl nonanoate (PubChem CID 155414836) has the molecular formula C21H36O5
and a molecular weight of 368.51 g/mol. Its IUPAC name is ethoxyethane;(4-hydroxy-3-methoxyphenyl)methyl nonanoate.
Molecular Properties
| Compound Name | ethoxyethane;(4-hydroxy-3-methoxyphenyl)methyl nonanoate |
| PubChem CID | 155414836 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | ethoxyethane;(4-hydroxy-3-methoxyphenyl)methyl nonanoate |
| SMILES | CCCCCCCCC(=O)OCc1ccc(O)c(OC)c1.CCOCC |
| InChI | InChI=1S/C17H26O4.C4H10O/c1-3-4-5-6-7-8-9-17(19)21-13-14-10-11-15(18)16(12-14)20-2;1-3-5-4-2/h10-12,18H,3-9,13H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | HNJHVVODPWGAGC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethoxyethane;(4-hydroxy-3-methoxyphenyl)methyl nonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;(4-hydroxy-3-methoxyphenyl)methyl nonanoate?
The IUPAC name of ethoxyethane;(4-hydroxy-3-methoxyphenyl)methyl nonanoate (CID 155414836) is ethoxyethane;(4-hydroxy-3-methoxyphenyl)methyl nonanoate.
What is the SMILES notation for ethoxyethane;(4-hydroxy-3-methoxyphenyl)methyl nonanoate?
The canonical SMILES for ethoxyethane;(4-hydroxy-3-methoxyphenyl)methyl nonanoate is CCCCCCCCC(=O)OCc1ccc(O)c(OC)c1.CCOCC.
What is the InChIKey of ethoxyethane;(4-hydroxy-3-methoxyphenyl)methyl nonanoate?
The InChIKey is HNJHVVODPWGAGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O4.C4H10O/c1-3-4-5-6-7-8-9-17(19)21-13-14-10-11-15(18)16(12-14)20-2;1-3-5-4-2/h10-12,18H,3-9,13H2,1-2H3;3-4H2,1-2H3.
What are the key properties of ethoxyethane;(4-hydroxy-3-methoxyphenyl)methyl nonanoate?
ethoxyethane;(4-hydroxy-3-methoxyphenyl)methyl nonanoate has a molecular weight of 368.51 g/mol, XLogP of 5.24, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;(4-hydroxy-3-methoxyphenyl)methyl nonanoate is sourced from PubChem (CID 155414836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).