C34H52O8 — CID 129308074
benzyl 4-hydroxy-3-methoxynonanoate;(4-hydroxy-3-methoxyphenyl)methyl nonanoate (PubChem CID 129308074) has the molecular formula C34H52O8 and a molecular weight of 588.78 g/mol. Its IUPAC name is benzyl 4-hydroxy-3-methoxynonanoate;(4-hydroxy-3-methoxyphenyl)methyl nonanoate.
| Compound Name | benzyl 4-hydroxy-3-methoxynonanoate;(4-hydroxy-3-methoxyphenyl)methyl nonanoate |
|---|---|
| PubChem CID | 129308074 |
| Molecular Formula | C34H52O8 |
| Molecular Weight | 588.78 g/mol |
| Exact Mass | 588.37 |
| IUPAC Name | benzyl 4-hydroxy-3-methoxynonanoate;(4-hydroxy-3-methoxyphenyl)methyl nonanoate |
| SMILES | CCCCCC(O)C(CC(=O)OCc1ccccc1)OC.CCCCCCCCC(=O)OCc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/2C17H26O4/c1-3-4-6-11-15(18)16(20-2)12-17(19)21-13-14-9-7-5-8-10-14;1-3-4-5-6-7-8-9-17(19)21-13-14-10-11-15(18)16(12-14)20-2/h5,7-10,15-16,18H,3-4,6,11-13H2,1-2H3;10-12,18H,3-9,13H2,1-2H3 |
| InChIKey | CLKWHBIOJXNIEE-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.78 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|