About (4-hydroxy-3-methoxyphenyl)methyl 10-methylundecanoate
(4-hydroxy-3-methoxyphenyl)methyl 10-methylundecanoate (PubChem CID 68603374) has the molecular formula C20H32O4
and a molecular weight of 336.47 g/mol. Its IUPAC name is (4-hydroxy-3-methoxyphenyl)methyl 10-methylundecanoate.
Molecular Properties
| Compound Name | (4-hydroxy-3-methoxyphenyl)methyl 10-methylundecanoate |
| PubChem CID | 68603374 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (4-hydroxy-3-methoxyphenyl)methyl 10-methylundecanoate |
| SMILES | COc1cc(COC(=O)CCCCCCCCC(C)C)ccc1O |
| InChI | InChI=1S/C20H32O4/c1-16(2)10-8-6-4-5-7-9-11-20(22)24-15-17-12-13-18(21)19(14-17)23-3/h12-14,16,21H,4-11,15H2,1-3H3 |
| InChIKey | GVYIBCHMUBJSKG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxy-3-methoxyphenyl)methyl 10-methylundecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxy-3-methoxyphenyl)methyl 10-methylundecanoate?
The IUPAC name of (4-hydroxy-3-methoxyphenyl)methyl 10-methylundecanoate (CID 68603374) is (4-hydroxy-3-methoxyphenyl)methyl 10-methylundecanoate.
What is the SMILES notation for (4-hydroxy-3-methoxyphenyl)methyl 10-methylundecanoate?
The canonical SMILES for (4-hydroxy-3-methoxyphenyl)methyl 10-methylundecanoate is COc1cc(COC(=O)CCCCCCCCC(C)C)ccc1O.
What is the InChIKey of (4-hydroxy-3-methoxyphenyl)methyl 10-methylundecanoate?
The InChIKey is GVYIBCHMUBJSKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32O4/c1-16(2)10-8-6-4-5-7-9-11-20(22)24-15-17-12-13-18(21)19(14-17)23-3/h12-14,16,21H,4-11,15H2,1-3H3.
What are the key properties of (4-hydroxy-3-methoxyphenyl)methyl 10-methylundecanoate?
(4-hydroxy-3-methoxyphenyl)methyl 10-methylundecanoate has a molecular weight of 336.47 g/mol, XLogP of 5.22, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxy-3-methoxyphenyl)methyl 10-methylundecanoate is sourced from PubChem (CID 68603374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).