About (3-ethoxy-4-hydroxyphenyl)methyl 7-methylnonanoate
(3-ethoxy-4-hydroxyphenyl)methyl 7-methylnonanoate (PubChem CID 24890752) has the molecular formula C19H30O4
and a molecular weight of 322.45 g/mol. Its IUPAC name is (3-ethoxy-4-hydroxyphenyl)methyl 7-methylnonanoate.
Molecular Properties
| Compound Name | (3-ethoxy-4-hydroxyphenyl)methyl 7-methylnonanoate |
| PubChem CID | 24890752 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | (3-ethoxy-4-hydroxyphenyl)methyl 7-methylnonanoate |
| SMILES | CCOc1cc(COC(=O)CCCCCC(C)CC)ccc1O |
| InChI | InChI=1S/C19H30O4/c1-4-15(3)9-7-6-8-10-19(21)23-14-16-11-12-17(20)18(13-16)22-5-2/h11-13,15,20H,4-10,14H2,1-3H3 |
| InChIKey | PAXWSYONWTUTLJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3-ethoxy-4-hydroxyphenyl)methyl 7-methylnonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethoxy-4-hydroxyphenyl)methyl 7-methylnonanoate?
The IUPAC name of (3-ethoxy-4-hydroxyphenyl)methyl 7-methylnonanoate (CID 24890752) is (3-ethoxy-4-hydroxyphenyl)methyl 7-methylnonanoate.
What is the SMILES notation for (3-ethoxy-4-hydroxyphenyl)methyl 7-methylnonanoate?
The canonical SMILES for (3-ethoxy-4-hydroxyphenyl)methyl 7-methylnonanoate is CCOc1cc(COC(=O)CCCCCC(C)CC)ccc1O.
What is the InChIKey of (3-ethoxy-4-hydroxyphenyl)methyl 7-methylnonanoate?
The InChIKey is PAXWSYONWTUTLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O4/c1-4-15(3)9-7-6-8-10-19(21)23-14-16-11-12-17(20)18(13-16)22-5-2/h11-13,15,20H,4-10,14H2,1-3H3.
What are the key properties of (3-ethoxy-4-hydroxyphenyl)methyl 7-methylnonanoate?
(3-ethoxy-4-hydroxyphenyl)methyl 7-methylnonanoate has a molecular weight of 322.45 g/mol, XLogP of 4.83, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethoxy-4-hydroxyphenyl)methyl 7-methylnonanoate is sourced from PubChem (CID 24890752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).