About 4-butoxy-2-methoxyphenol
4-butoxy-2-methoxyphenol (PubChem CID 53249740) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-butoxy-2-methoxyphenol.
Molecular Properties
| Compound Name | 4-butoxy-2-methoxyphenol |
| PubChem CID | 53249740 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 4-butoxy-2-methoxyphenol |
| SMILES | CCCCOc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C11H16O3/c1-3-4-7-14-9-5-6-10(12)11(8-9)13-2/h5-6,8,12H,3-4,7H2,1-2H3 |
| InChIKey | LUCJGAGJVQJIOE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-butoxy-2-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butoxy-2-methoxyphenol?
The IUPAC name of 4-butoxy-2-methoxyphenol (CID 53249740) is 4-butoxy-2-methoxyphenol.
What is the SMILES notation for 4-butoxy-2-methoxyphenol?
The canonical SMILES for 4-butoxy-2-methoxyphenol is CCCCOc1ccc(O)c(OC)c1.
What is the InChIKey of 4-butoxy-2-methoxyphenol?
The InChIKey is LUCJGAGJVQJIOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-3-4-7-14-9-5-6-10(12)11(8-9)13-2/h5-6,8,12H,3-4,7H2,1-2H3.
What are the key properties of 4-butoxy-2-methoxyphenol?
4-butoxy-2-methoxyphenol has a molecular weight of 196.25 g/mol, XLogP of 2.58, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butoxy-2-methoxyphenol is sourced from PubChem (CID 53249740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).