C9H13O7P — CID 67374454
2-(4-hydroxy-3-methoxyphenoxy)ethyl dihydrogen phosphate (PubChem CID 67374454) has the molecular formula C9H13O7P and a molecular weight of 264.17 g/mol. Its IUPAC name is 2-(4-hydroxy-3-methoxyphenoxy)ethyl dihydrogen phosphate.
| Compound Name | 2-(4-hydroxy-3-methoxyphenoxy)ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 67374454 |
| Molecular Formula | C9H13O7P |
| Molecular Weight | 264.17 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 2-(4-hydroxy-3-methoxyphenoxy)ethyl dihydrogen phosphate |
| SMILES | COc1cc(OCCOP(=O)(O)O)ccc1O |
| InChI | InChI=1S/C9H13O7P/c1-14-9-6-7(2-3-8(9)10)15-4-5-16-17(11,12)13/h2-3,6,10H,4-5H2,1H3,(H2,11,12,13) |
| InChIKey | WDVIXCSDTZZEMI-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.17 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|