C9H14NO6P — CID 131964251
2-(3-amino-5-methoxyphenoxy)ethyl dihydrogen phosphate (PubChem CID 131964251) has the molecular formula C9H14NO6P and a molecular weight of 263.19 g/mol. Its IUPAC name is 2-(3-amino-5-methoxyphenoxy)ethyl dihydrogen phosphate.
| Compound Name | 2-(3-amino-5-methoxyphenoxy)ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 131964251 |
| Molecular Formula | C9H14NO6P |
| Molecular Weight | 263.19 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 2-(3-amino-5-methoxyphenoxy)ethyl dihydrogen phosphate |
| SMILES | COc1cc(N)cc(OCCOP(=O)(O)O)c1 |
| InChI | InChI=1S/C9H14NO6P/c1-14-8-4-7(10)5-9(6-8)15-2-3-16-17(11,12)13/h4-6H,2-3,10H2,1H3,(H2,11,12,13) |
| InChIKey | AZVAODJRHZYCAK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.19 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|