C15H24O4Si — CID 20667337
4-[3-[dimethyl(prop-2-enoxy)silyl]propoxy]-2-methoxyphenol (PubChem CID 20667337) has the molecular formula C15H24O4Si and a molecular weight of 296.44 g/mol. Its IUPAC name is 4-[3-[dimethyl(prop-2-enoxy)silyl]propoxy]-2-methoxyphenol.
| Compound Name | 4-[3-[dimethyl(prop-2-enoxy)silyl]propoxy]-2-methoxyphenol |
|---|---|
| PubChem CID | 20667337 |
| Molecular Formula | C15H24O4Si |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 4-[3-[dimethyl(prop-2-enoxy)silyl]propoxy]-2-methoxyphenol |
| SMILES | C=CCO[Si](C)(C)CCCOc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C15H24O4Si/c1-5-9-19-20(3,4)11-6-10-18-13-7-8-14(16)15(12-13)17-2/h5,7-8,12,16H,1,6,9-11H2,2-4H3 |
| InChIKey | RZJUKOLWWYUOFB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|