C18H23O8P — CID 164613132
bis[2-(4-hydroxy-3-methoxyphenyl)ethyl] hydrogen phosphate (PubChem CID 164613132) has the molecular formula C18H23O8P and a molecular weight of 398.35 g/mol. Its IUPAC name is bis[2-(4-hydroxy-3-methoxyphenyl)ethyl] hydrogen phosphate.
| Compound Name | bis[2-(4-hydroxy-3-methoxyphenyl)ethyl] hydrogen phosphate |
|---|---|
| PubChem CID | 164613132 |
| Molecular Formula | C18H23O8P |
| Molecular Weight | 398.35 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | bis[2-(4-hydroxy-3-methoxyphenyl)ethyl] hydrogen phosphate |
| SMILES | COc1cc(CCOP(=O)(O)OCCc2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C18H23O8P/c1-23-17-11-13(3-5-15(17)19)7-9-25-27(21,22)26-10-8-14-4-6-16(20)18(12-14)24-2/h3-6,11-12,19-20H,7-10H2,1-2H3,(H,21,22) |
| InChIKey | VYSMYRAXQIEHBN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|