C20H22MgO8 — CID 154644614
magnesium bis(3-(4-hydroxy-3-methoxyphenyl)propanoate) (PubChem CID 154644614) has the molecular formula C20H22MgO8 and a molecular weight of 414.69 g/mol. Its IUPAC name is magnesium bis(3-(4-hydroxy-3-methoxyphenyl)propanoate).
| Compound Name | magnesium bis(3-(4-hydroxy-3-methoxyphenyl)propanoate) |
|---|---|
| PubChem CID | 154644614 |
| Molecular Formula | C20H22MgO8 |
| Molecular Weight | 414.69 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | magnesium bis(3-(4-hydroxy-3-methoxyphenyl)propanoate) |
| SMILES | COc1cc(CCC(=O)[O-])ccc1O.COc1cc(CCC(=O)[O-])ccc1O.[Mg+2] |
| InChI | InChI=1S/2C10H12O4.Mg/c2*1-14-9-6-7(2-4-8(9)11)3-5-10(12)13;/h2*2,4,6,11H,3,5H2,1H3,(H,12,13);/q;;+2/p-2 |
| InChIKey | KZFNSBAOCBTYQH-UHFFFAOYSA-L |
| XLogP | -0.21 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.69 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |