C23H26O8 — CID 134337029
methyl 5-(4-hydroxy-3-methoxyphenyl)-2-[3-(4-hydroxy-3-methoxyphenyl)propanoyl]-3-oxopentanoate (PubChem CID 134337029) has the molecular formula C23H26O8 and a molecular weight of 430.45 g/mol. Its IUPAC name is methyl 5-(4-hydroxy-3-methoxyphenyl)-2-[3-(4-hydroxy-3-methoxyphenyl)propanoyl]-3-oxopentanoate.
| Compound Name | methyl 5-(4-hydroxy-3-methoxyphenyl)-2-[3-(4-hydroxy-3-methoxyphenyl)propanoyl]-3-oxopentanoate |
|---|---|
| PubChem CID | 134337029 |
| Molecular Formula | C23H26O8 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | methyl 5-(4-hydroxy-3-methoxyphenyl)-2-[3-(4-hydroxy-3-methoxyphenyl)propanoyl]-3-oxopentanoate |
| SMILES | COC(=O)C(C(=O)CCc1ccc(O)c(OC)c1)C(=O)CCc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C23H26O8/c1-29-20-12-14(4-8-16(20)24)6-10-18(26)22(23(28)31-3)19(27)11-7-15-5-9-17(25)21(13-15)30-2/h4-5,8-9,12-13,22,24-25H,6-7,10-11H2,1-3H3 |
| InChIKey | UMPVBLOLHBSJSZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|