C13H18O5 — CID 21224421
ethyl 2-hydroxy-4-(4-hydroxy-3-methoxyphenyl)butanoate (PubChem CID 21224421) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is ethyl 2-hydroxy-4-(4-hydroxy-3-methoxyphenyl)butanoate.
| Compound Name | ethyl 2-hydroxy-4-(4-hydroxy-3-methoxyphenyl)butanoate |
|---|---|
| PubChem CID | 21224421 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | ethyl 2-hydroxy-4-(4-hydroxy-3-methoxyphenyl)butanoate |
| SMILES | CCOC(=O)C(O)CCc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C13H18O5/c1-3-18-13(16)11(15)7-5-9-4-6-10(14)12(8-9)17-2/h4,6,8,11,14-15H,3,5,7H2,1-2H3 |
| InChIKey | HUHRJNIXYDTOGI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |