C23H32O6 — CID 163420206
1,7-bis(4-hydroxy-3-methoxyphenyl)-4,4-dimethylheptane-3,5-diol (PubChem CID 163420206) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is 1,7-bis(4-hydroxy-3-methoxyphenyl)-4,4-dimethylheptane-3,5-diol.
| Compound Name | 1,7-bis(4-hydroxy-3-methoxyphenyl)-4,4-dimethylheptane-3,5-diol |
|---|---|
| PubChem CID | 163420206 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 1,7-bis(4-hydroxy-3-methoxyphenyl)-4,4-dimethylheptane-3,5-diol |
| SMILES | COc1cc(CCC(O)C(C)(C)C(O)CCc2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C23H32O6/c1-23(2,21(26)11-7-15-5-9-17(24)19(13-15)28-3)22(27)12-8-16-6-10-18(25)20(14-16)29-4/h5-6,9-10,13-14,21-22,24-27H,7-8,11-12H2,1-4H3 |
| InChIKey | AHVFMIUVPDKNNK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |