C21H28O6 — CID 10883331
(3R,5R)-1,7-bis(4-hydroxy-3-methoxyphenyl)heptane-3,5-diol (PubChem CID 10883331) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is (3R,5R)-1,7-bis(4-hydroxy-3-methoxyphenyl)heptane-3,5-diol.
| Compound Name | (3R,5R)-1,7-bis(4-hydroxy-3-methoxyphenyl)heptane-3,5-diol |
|---|---|
| PubChem CID | 10883331 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (3R,5R)-1,7-bis(4-hydroxy-3-methoxyphenyl)heptane-3,5-diol |
| SMILES | COc1cc(CC[C@@H](O)C[C@H](O)CCc2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C21H28O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h5-6,9-12,16-17,22-25H,3-4,7-8,13H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | OELMAFBLFOKZJD-IAGOWNOFSA-N |
| XLogP | 2.79 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |