C19H33O4+ — CID 143193328
[3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)dodecan-5-yl]oxidanium (PubChem CID 143193328) has the molecular formula C19H33O4+ and a molecular weight of 325.47 g/mol. Its IUPAC name is [3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)dodecan-5-yl]oxidanium.
| Compound Name | [3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)dodecan-5-yl]oxidanium |
|---|---|
| PubChem CID | 143193328 |
| Molecular Formula | C19H33O4+ |
| Molecular Weight | 325.47 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | [3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)dodecan-5-yl]oxidanium |
| SMILES | CCCCCCCC([OH2+])CC(O)CCc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C19H32O4/c1-3-4-5-6-7-8-16(20)14-17(21)11-9-15-10-12-18(22)19(13-15)23-2/h10,12-13,16-17,20-22H,3-9,11,14H2,1-2H3/p+1 |
| InChIKey | RLBBNYBPCMIQMG-UHFFFAOYSA-O |
| XLogP | 3.54 |
| TPSA | 72.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|