C20H32O3 — CID 137432150
2-methoxy-4-[2-(3-nonyloxiran-2-yl)ethyl]phenol (PubChem CID 137432150) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 2-methoxy-4-[2-(3-nonyloxiran-2-yl)ethyl]phenol.
| Compound Name | 2-methoxy-4-[2-(3-nonyloxiran-2-yl)ethyl]phenol |
|---|---|
| PubChem CID | 137432150 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 2-methoxy-4-[2-(3-nonyloxiran-2-yl)ethyl]phenol |
| SMILES | CCCCCCCCCC1OC1CCc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C20H32O3/c1-3-4-5-6-7-8-9-10-18-19(23-18)14-12-16-11-13-17(21)20(15-16)22-2/h11,13,15,18-19,21H,3-10,12,14H2,1-2H3 |
| InChIKey | VRXSYFLIAGHYRG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|