C19H34O4 — CID 156738617
ethane;1-(4-hydroxy-3-methoxyphenyl)decane-3,5-diol (PubChem CID 156738617) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is ethane;1-(4-hydroxy-3-methoxyphenyl)decane-3,5-diol.
| Compound Name | ethane;1-(4-hydroxy-3-methoxyphenyl)decane-3,5-diol |
|---|---|
| PubChem CID | 156738617 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | ethane;1-(4-hydroxy-3-methoxyphenyl)decane-3,5-diol |
| SMILES | CC.CCCCCC(O)CC(O)CCc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C17H28O4.C2H6/c1-3-4-5-6-14(18)12-15(19)9-7-13-8-10-16(20)17(11-13)21-2;1-2/h8,10-11,14-15,18-20H,3-7,9,12H2,1-2H3;1-2H3 |
| InChIKey | MVQQJGJZRDBOCR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|