C18H30O3 — CID 154712075
(3R,5R)-1-(4-methoxyphenyl)undecane-3,5-diol (PubChem CID 154712075) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is (3R,5R)-1-(4-methoxyphenyl)undecane-3,5-diol.
| Compound Name | (3R,5R)-1-(4-methoxyphenyl)undecane-3,5-diol |
|---|---|
| PubChem CID | 154712075 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (3R,5R)-1-(4-methoxyphenyl)undecane-3,5-diol |
| SMILES | CCCCCC[C@@H](O)C[C@H](O)CCc1ccc(OC)cc1 |
| InChI | InChI=1S/C18H30O3/c1-3-4-5-6-7-16(19)14-17(20)11-8-15-9-12-18(21-2)13-10-15/h9-10,12-13,16-17,19-20H,3-8,11,14H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | NJPCPXNSHNUAOM-IAGOWNOFSA-N |
| XLogP | 3.71 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|