C14H19F3O2 — CID 115828386
7,7,7-trifluoro-1-(4-methoxyphenyl)heptan-3-ol (PubChem CID 115828386) has the molecular formula C14H19F3O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 7,7,7-trifluoro-1-(4-methoxyphenyl)heptan-3-ol.
| Compound Name | 7,7,7-trifluoro-1-(4-methoxyphenyl)heptan-3-ol |
|---|---|
| PubChem CID | 115828386 |
| Molecular Formula | C14H19F3O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 7,7,7-trifluoro-1-(4-methoxyphenyl)heptan-3-ol |
| SMILES | COc1ccc(CCC(O)CCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H19F3O2/c1-19-13-8-5-11(6-9-13)4-7-12(18)3-2-10-14(15,16)17/h5-6,8-9,12,18H,2-4,7,10H2,1H3 |
| InChIKey | YKMUPFUQFIPPJJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |