C14H20F3NO — CID 115516486
6,6,6-trifluoro-1-(4-methoxyphenyl)-N-methylhexan-2-amine (PubChem CID 115516486) has the molecular formula C14H20F3NO and a molecular weight of 275.31 g/mol. Its IUPAC name is 6,6,6-trifluoro-1-(4-methoxyphenyl)-N-methylhexan-2-amine.
| Compound Name | 6,6,6-trifluoro-1-(4-methoxyphenyl)-N-methylhexan-2-amine |
|---|---|
| PubChem CID | 115516486 |
| Molecular Formula | C14H20F3NO |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 6,6,6-trifluoro-1-(4-methoxyphenyl)-N-methylhexan-2-amine |
| SMILES | CNC(CCCC(F)(F)F)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C14H20F3NO/c1-18-12(4-3-9-14(15,16)17)10-11-5-7-13(19-2)8-6-11/h5-8,12,18H,3-4,9-10H2,1-2H3 |
| InChIKey | CFWHMSZRJZMPOM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |