C13H18F3NO — CID 116534060
4-methoxy-N-(6,6,6-trifluorohexan-2-yl)aniline (PubChem CID 116534060) has the molecular formula C13H18F3NO and a molecular weight of 261.29 g/mol. Its IUPAC name is 4-methoxy-N-(6,6,6-trifluorohexan-2-yl)aniline.
| Compound Name | 4-methoxy-N-(6,6,6-trifluorohexan-2-yl)aniline |
|---|---|
| PubChem CID | 116534060 |
| Molecular Formula | C13H18F3NO |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 4-methoxy-N-(6,6,6-trifluorohexan-2-yl)aniline |
| SMILES | COc1ccc(NC(C)CCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H18F3NO/c1-10(4-3-9-13(14,15)16)17-11-5-7-12(18-2)8-6-11/h5-8,10,17H,3-4,9H2,1-2H3 |
| InChIKey | WFQAHWSUGZXPRL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|